C27H50BN3O6 — CID 66832736
tert-butyl (3R)-3-[2-acetamido-1-(tert-butylamino)-1-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-2-yl]pyrrolidine-1-carboxylate (PubChem CID 66832736) has the molecular formula C27H50BN3O6 and a molecular weight of 523.52 g/mol. Its IUPAC name is tert-butyl (3R)-3-[2-acetamido-1-(tert-butylamino)-1-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[2-acetamido-1-(tert-butylamino)-1-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66832736 |
| Molecular Formula | C27H50BN3O6 |
| Molecular Weight | 523.52 g/mol |
| Exact Mass | 523.38 |
| IUPAC Name | tert-butyl (3R)-3-[2-acetamido-1-(tert-butylamino)-1-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)NC(CCCCB1OC(C)(C)C(C)(C)O1)(C(=O)NC(C)(C)C)[C@@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C27H50BN3O6/c1-19(32)29-27(21(33)30-23(2,3)4,20-14-17-31(18-20)22(34)35-24(5,6)7)15-12-13-16-28-36-25(8,9)26(10,11)37-28/h20H,12-18H2,1-11H3,(H,29,32)(H,30,33)/t20-,27?/m1/s1 |
| InChIKey | SOAVRDJUSHGKEI-ACVCQEAVSA-N |
| XLogP | 4.30 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|