C23H42BNO7 — CID 155793127
1-O-tert-butyl 2-O-methyl (2S,3S,4R)-4-methoxy-2,3-dimethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 155793127) has the molecular formula C23H42BNO7 and a molecular weight of 455.40 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,3S,4R)-4-methoxy-2,3-dimethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,3S,4R)-4-methoxy-2,3-dimethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155793127 |
| Molecular Formula | C23H42BNO7 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,3S,4R)-4-methoxy-2,3-dimethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@]1(C)N(C(=O)OC(C)(C)C)C[C@H](OC)[C@@]1(C)CCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H42BNO7/c1-19(2,3)30-18(27)25-15-16(28-10)22(8,23(25,9)17(26)29-11)13-12-14-24-31-20(4,5)21(6,7)32-24/h16H,12-15H2,1-11H3/t16-,22+,23+/m0/s1 |
| InChIKey | ITJMRLMKYGNDSM-PBNUPURSSA-N |
| XLogP | 4.06 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|