C27H48B2O8 — CID 177481584
trans-dimethyl (3S,4S)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclopentane-1,1-dicarboxylate (PubChem CID 177481584) has the molecular formula C27H48B2O8 and a molecular weight of 522.30 g/mol. Its IUPAC name is trans-dimethyl (3S,4S)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (3S,4S)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 177481584 |
| Molecular Formula | C27H48B2O8 |
| Molecular Weight | 522.30 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | trans-dimethyl (3S,4S)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](CCCCB2OC(C)(C)C(C)(C)O2)[C@@H](CCB2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C27H48B2O8/c1-23(2)24(3,4)35-28(34-23)15-12-11-13-19-17-27(21(30)32-9,22(31)33-10)18-20(19)14-16-29-36-25(5,6)26(7,8)37-29/h19-20H,11-18H2,1-10H3/t19-,20-/m0/s1 |
| InChIKey | PZWGTSYEAQCFGY-PMACEKPBSA-N |
| XLogP | 5.09 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|