C19H30BNO7 — CID 123379641
(2,5-dihydroxypyrrol-1-yl) [(1R,2R)-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]cyclopropyl] carbonate (PubChem CID 123379641) has the molecular formula C19H30BNO7 and a molecular weight of 395.26 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) [(1R,2R)-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]cyclopropyl] carbonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) [(1R,2R)-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]cyclopropyl] carbonate |
|---|---|
| PubChem CID | 123379641 |
| Molecular Formula | C19H30BNO7 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) [(1R,2R)-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]cyclopropyl] carbonate |
| SMILES | CC1(C)OB(CCCCC[C@@H]2C[C@H]2OC(=O)On2c(O)ccc2O)OC1(C)C |
| InChI | InChI=1S/C19H30BNO7/c1-18(2)19(3,4)28-20(27-18)11-7-5-6-8-13-12-14(13)25-17(24)26-21-15(22)9-10-16(21)23/h9-10,13-14,22-23H,5-8,11-12H2,1-4H3/t13-,14-/m1/s1 |
| InChIKey | UPNCRGWMRKNTBS-ZIAGYGMSSA-N |
| XLogP | 3.51 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|