C23H34BNO6 — CID 155793078
1-O-benzyl 2-O-methyl (2R,3R)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 155793078) has the molecular formula C23H34BNO6 and a molecular weight of 431.34 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2R,3R)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2R,3R)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155793078 |
| Molecular Formula | C23H34BNO6 |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2R,3R)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](CCCB2OC(C)(C)C(C)(C)O2)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H34BNO6/c1-22(2)23(3,4)31-24(30-22)14-9-12-18-13-15-25(19(18)20(26)28-5)21(27)29-16-17-10-7-6-8-11-17/h6-8,10-11,18-19H,9,12-16H2,1-5H3/t18-,19-/m1/s1 |
| InChIKey | ZCESMTLEOKSBLU-RTBURBONSA-N |
| XLogP | 4.06 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|