C25H38BNO7 — CID 155793251
1-O-benzyl 2-O-methyl (2S,3S,4R,5R)-4-hydroxy-3,5-dimethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 155793251) has the molecular formula C25H38BNO7 and a molecular weight of 475.39 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,3S,4R,5R)-4-hydroxy-3,5-dimethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,3S,4R,5R)-4-hydroxy-3,5-dimethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155793251 |
| Molecular Formula | C25H38BNO7 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,3S,4R,5R)-4-hydroxy-3,5-dimethyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1N(C(=O)OCc2ccccc2)[C@H](C)[C@H](O)[C@@]1(C)CCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H38BNO7/c1-17-20(28)25(6,14-11-15-26-33-23(2,3)24(4,5)34-26)19(21(29)31-7)27(17)22(30)32-16-18-12-9-8-10-13-18/h8-10,12-13,17,19-20,28H,11,14-16H2,1-7H3/t17-,19-,20+,25+/m1/s1 |
| InChIKey | JTYFOIDXFFPGBI-WKVINZIJSA-N |
| XLogP | 3.81 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|