C27H43BN2O6 — CID 155793151
1-O-benzyl 2-O-methyl (2S,3R,4S)-4-[(dimethylamino)methyl]-3-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 155793151) has the molecular formula C27H43BN2O6 and a molecular weight of 502.46 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,3R,4S)-4-[(dimethylamino)methyl]-3-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,3R,4S)-4-[(dimethylamino)methyl]-3-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155793151 |
| Molecular Formula | C27H43BN2O6 |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,3R,4S)-4-[(dimethylamino)methyl]-3-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1N(C(=O)OCc2ccccc2)C[C@H](CN(C)C)[C@@]1(C)CCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C27H43BN2O6/c1-25(2)26(3,4)36-28(35-25)16-12-15-27(5)21(17-29(6)7)18-30(22(27)23(31)33-8)24(32)34-19-20-13-10-9-11-14-20/h9-11,13-14,21-22H,12,15-19H2,1-8H3/t21-,22+,27+/m0/s1 |
| InChIKey | NAZLNBMDBAWIJS-OREGWCPLSA-N |
| XLogP | 4.24 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|