C22H34BNO4 — CID 153335198
benzyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylate (PubChem CID 153335198) has the molecular formula C22H34BNO4 and a molecular weight of 387.33 g/mol. Its IUPAC name is benzyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 153335198 |
| Molecular Formula | C22H34BNO4 |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | benzyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylate |
| SMILES | CC1(C)OB(CCCCC2(C(=O)OCc3ccccc3)CCCN2)OC1(C)C |
| InChI | InChI=1S/C22H34BNO4/c1-20(2)21(3,4)28-23(27-20)15-9-8-13-22(14-10-16-24-22)19(25)26-17-18-11-6-5-7-12-18/h5-7,11-12,24H,8-10,13-17H2,1-4H3 |
| InChIKey | XRQBLVZEADJYBO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|