C24H35BN4O4 — CID 155761163
benzyl (3aR,4S,5S,6aR)-5-azido-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxylate (PubChem CID 155761163) has the molecular formula C24H35BN4O4 and a molecular weight of 454.38 g/mol. Its IUPAC name is benzyl (3aR,4S,5S,6aR)-5-azido-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxylate.
| Compound Name | benzyl (3aR,4S,5S,6aR)-5-azido-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 155761163 |
| Molecular Formula | C24H35BN4O4 |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | benzyl (3aR,4S,5S,6aR)-5-azido-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5-carboxylate |
| SMILES | CC1(C)OB(CCC[C@H]2[C@@H]3CNC[C@@H]3C[C@@]2(N=[N+]=[N-])C(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C24H35BN4O4/c1-22(2)23(3,4)33-25(32-22)12-8-11-20-19-15-27-14-18(19)13-24(20,28-29-26)21(30)31-16-17-9-6-5-7-10-17/h5-7,9-10,18-20,27H,8,11-16H2,1-4H3/t18-,19+,20-,24-/m0/s1 |
| InChIKey | FZZGDPPIGVUESP-VKDGWMQASA-N |
| XLogP | 4.51 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|