C19H27N5O3 — CID 129088378
benzyl (3R,4S)-1-[(2S)-2-aminopropanoyl]-3-azido-4-butylpyrrolidine-3-carboxylate (PubChem CID 129088378) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is benzyl (3R,4S)-1-[(2S)-2-aminopropanoyl]-3-azido-4-butylpyrrolidine-3-carboxylate.
| Compound Name | benzyl (3R,4S)-1-[(2S)-2-aminopropanoyl]-3-azido-4-butylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 129088378 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | benzyl (3R,4S)-1-[(2S)-2-aminopropanoyl]-3-azido-4-butylpyrrolidine-3-carboxylate |
| SMILES | CCCC[C@H]1CN(C(=O)[C@H](C)N)C[C@@]1(N=[N+]=[N-])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H27N5O3/c1-3-4-10-16-11-24(17(25)14(2)20)13-19(16,22-23-21)18(26)27-12-15-8-6-5-7-9-15/h5-9,14,16H,3-4,10-13,20H2,1-2H3/t14-,16-,19-/m0/s1 |
| InChIKey | SRPQGDJMTRYQNJ-QOKNQOGYSA-N |
| XLogP | 2.77 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|