C16H19N3O2 — CID 167654559
trans-benzyl (1S,2R)-1-azido-2-prop-2-enylcyclopentane-1-carboxylate (PubChem CID 167654559) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is trans-benzyl (1S,2R)-1-azido-2-prop-2-enylcyclopentane-1-carboxylate.
| Compound Name | trans-benzyl (1S,2R)-1-azido-2-prop-2-enylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 167654559 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | trans-benzyl (1S,2R)-1-azido-2-prop-2-enylcyclopentane-1-carboxylate |
| SMILES | C=CC[C@H]1CCC[C@@]1(N=[N+]=[N-])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H19N3O2/c1-2-7-14-10-6-11-16(14,18-19-17)15(20)21-12-13-8-4-3-5-9-13/h2-5,8-9,14H,1,6-7,10-12H2/t14-,16-/m0/s1 |
| InChIKey | RBJVZKHFJZAORP-HOCLYGCPSA-N |
| XLogP | 4.16 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|