C15H21N3O4S — CID 155204762
benzyl (3R,4S)-3-amino-4-prop-2-enyl-1-sulfamoylpyrrolidine-3-carboxylate (PubChem CID 155204762) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is benzyl (3R,4S)-3-amino-4-prop-2-enyl-1-sulfamoylpyrrolidine-3-carboxylate.
| Compound Name | benzyl (3R,4S)-3-amino-4-prop-2-enyl-1-sulfamoylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 155204762 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | benzyl (3R,4S)-3-amino-4-prop-2-enyl-1-sulfamoylpyrrolidine-3-carboxylate |
| SMILES | C=CC[C@H]1CN(S(N)(=O)=O)C[C@@]1(N)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H21N3O4S/c1-2-6-13-9-18(23(17,20)21)11-15(13,16)14(19)22-10-12-7-4-3-5-8-12/h2-5,7-8,13H,1,6,9-11,16H2,(H2,17,20,21)/t13-,15-/m0/s1 |
| InChIKey | FQCXZIMRQQAGDU-ZFWWWQNUSA-N |
| XLogP | 0.14 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|