C15H20N2O2 — CID 166951895
benzyl (3R,4S)-3-amino-4-prop-2-enylpyrrolidine-3-carboxylate (PubChem CID 166951895) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is benzyl (3R,4S)-3-amino-4-prop-2-enylpyrrolidine-3-carboxylate.
| Compound Name | benzyl (3R,4S)-3-amino-4-prop-2-enylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 166951895 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | benzyl (3R,4S)-3-amino-4-prop-2-enylpyrrolidine-3-carboxylate |
| SMILES | C=CC[C@H]1CNC[C@@]1(N)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O2/c1-2-6-13-9-17-11-15(13,16)14(18)19-10-12-7-4-3-5-8-12/h2-5,7-8,13,17H,1,6,9-11,16H2/t13-,15-/m0/s1 |
| InChIKey | JBBOSAZYUPJWQG-ZFWWWQNUSA-N |
| XLogP | 1.22 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|