C18H23N3O2 — CID 146282540
benzyl (2S,3R,4R)-1-azido-3,4-dimethyl-2-prop-2-enylcyclopentane-1-carboxylate (PubChem CID 146282540) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is benzyl (2S,3R,4R)-1-azido-3,4-dimethyl-2-prop-2-enylcyclopentane-1-carboxylate.
| Compound Name | benzyl (2S,3R,4R)-1-azido-3,4-dimethyl-2-prop-2-enylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 146282540 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | benzyl (2S,3R,4R)-1-azido-3,4-dimethyl-2-prop-2-enylcyclopentane-1-carboxylate |
| SMILES | C=CC[C@H]1[C@H](C)[C@H](C)CC1(N=[N+]=[N-])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H23N3O2/c1-4-8-16-14(3)13(2)11-18(16,20-21-19)17(22)23-12-15-9-6-5-7-10-15/h4-7,9-10,13-14,16H,1,8,11-12H2,2-3H3/t13-,14-,16+,18?/m1/s1 |
| InChIKey | YBHAKYNSGZMKSR-UYFHTVFMSA-N |
| XLogP | 4.65 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|