C22H32N6O6S — CID 175774895
benzyl (3S,4R)-3-azido-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate (PubChem CID 175774895) has the molecular formula C22H32N6O6S and a molecular weight of 508.60 g/mol. Its IUPAC name is benzyl (3S,4R)-3-azido-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate.
| Compound Name | benzyl (3S,4R)-3-azido-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 175774895 |
| Molecular Formula | C22H32N6O6S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | benzyl (3S,4R)-3-azido-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate |
| SMILES | C=CC[C@@H]1CN(S(=O)(=O)NCCNC(=O)OC(C)(C)C)C[C@]1(N=[N+]=[N-])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H32N6O6S/c1-5-9-18-14-28(35(31,32)25-13-12-24-20(30)34-21(2,3)4)16-22(18,26-27-23)19(29)33-15-17-10-7-6-8-11-17/h5-8,10-11,18,25H,1,9,12-16H2,2-4H3,(H,24,30)/t18-,22-/m1/s1 |
| InChIKey | LIVAEDGJLBQRSG-XMSQKQJNSA-N |
| XLogP | 2.65 |
| TPSA | 162.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|