C15H28BN5O6S — CID 155627341
iminoboranyl (3R,4S)-3-amino-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate (PubChem CID 155627341) has the molecular formula C15H28BN5O6S and a molecular weight of 417.30 g/mol. Its IUPAC name is iminoboranyl (3R,4S)-3-amino-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate.
| Compound Name | iminoboranyl (3R,4S)-3-amino-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 155627341 |
| Molecular Formula | C15H28BN5O6S |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | iminoboranyl (3R,4S)-3-amino-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]-4-prop-2-enylpyrrolidine-3-carboxylate |
| SMILES | [H]/N=B/OC(=O)[C@]1(N)CN(S(=O)(=O)NCCNC(=O)OC(C)(C)C)C[C@@H]1CC=C |
| InChI | InChI=1S/C15H28BN5O6S/c1-5-6-11-9-21(10-15(11,17)12(22)27-16-18)28(24,25)20-8-7-19-13(23)26-14(2,3)4/h5,11,18,20H,1,6-10,17H2,2-4H3,(H,19,23)/t11-,15-/m0/s1 |
| InChIKey | XUICEDUZRHYPLN-NHYWBVRUSA-N |
| XLogP | -0.52 |
| TPSA | 163.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|