C19H30N4O6S — CID 155056221
benzyl (3R)-3-amino-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]pyrrolidine-3-carboxylate (PubChem CID 155056221) has the molecular formula C19H30N4O6S and a molecular weight of 442.54 g/mol. Its IUPAC name is benzyl (3R)-3-amino-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]pyrrolidine-3-carboxylate.
| Compound Name | benzyl (3R)-3-amino-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 155056221 |
| Molecular Formula | C19H30N4O6S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | benzyl (3R)-3-amino-1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]pyrrolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)NCCNS(=O)(=O)N1CC[C@](N)(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C19H30N4O6S/c1-18(2,3)29-17(25)21-10-11-22-30(26,27)23-12-9-19(20,14-23)16(24)28-13-15-7-5-4-6-8-15/h4-8,22H,9-14,20H2,1-3H3,(H,21,25)/t19-/m1/s1 |
| InChIKey | NJWWIRHORZTJJS-LJQANCHMSA-N |
| XLogP | 0.49 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|