C12H23FN2O4S — CID 118874546
tert-butyl N-[(4-fluoro-1-methylsulfonylpiperidin-4-yl)methyl]carbamate (PubChem CID 118874546) has the molecular formula C12H23FN2O4S and a molecular weight of 310.39 g/mol. Its IUPAC name is tert-butyl N-[(4-fluoro-1-methylsulfonylpiperidin-4-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(4-fluoro-1-methylsulfonylpiperidin-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 118874546 |
| Molecular Formula | C12H23FN2O4S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | tert-butyl N-[(4-fluoro-1-methylsulfonylpiperidin-4-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(F)CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C12H23FN2O4S/c1-11(2,3)19-10(16)14-9-12(13)5-7-15(8-6-12)20(4,17)18/h5-9H2,1-4H3,(H,14,16) |
| InChIKey | NBIDRFMBAGQGTL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |