C10H16F2INO2 — CID 170915051
tert-butyl N-[[2,2-difluoro-1-(iodomethyl)cyclopropyl]methyl]carbamate (PubChem CID 170915051) has the molecular formula C10H16F2INO2 and a molecular weight of 347.14 g/mol. Its IUPAC name is tert-butyl N-[[2,2-difluoro-1-(iodomethyl)cyclopropyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2,2-difluoro-1-(iodomethyl)cyclopropyl]methyl]carbamate |
|---|---|
| PubChem CID | 170915051 |
| Molecular Formula | C10H16F2INO2 |
| Molecular Weight | 347.14 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | tert-butyl N-[[2,2-difluoro-1-(iodomethyl)cyclopropyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(CI)CC1(F)F |
| InChI | InChI=1S/C10H16F2INO2/c1-8(2,3)16-7(15)14-6-9(5-13)4-10(9,11)12/h4-6H2,1-3H3,(H,14,15) |
| InChIKey | MCGKMKHYECHPFV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.14 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|