C11H16F3NO3 — CID 91647554
tert-butyl N-[[3-oxo-1-(trifluoromethyl)cyclobutyl]methyl]carbamate (PubChem CID 91647554) has the molecular formula C11H16F3NO3 and a molecular weight of 267.25 g/mol. Its IUPAC name is tert-butyl N-[[3-oxo-1-(trifluoromethyl)cyclobutyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-oxo-1-(trifluoromethyl)cyclobutyl]methyl]carbamate |
|---|---|
| PubChem CID | 91647554 |
| Molecular Formula | C11H16F3NO3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | tert-butyl N-[[3-oxo-1-(trifluoromethyl)cyclobutyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(C(F)(F)F)CC(=O)C1 |
| InChI | InChI=1S/C11H16F3NO3/c1-9(2,3)18-8(17)15-6-10(11(12,13)14)4-7(16)5-10/h4-6H2,1-3H3,(H,15,17) |
| InChIKey | XDYXCXMMKKEGSA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |