C8H12F3NO3 — CID 129451512
tert-butyl N-(3,3,3-trifluoro-2-oxopropyl)carbamate (PubChem CID 129451512) has the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. Its IUPAC name is tert-butyl N-(3,3,3-trifluoro-2-oxopropyl)carbamate.
| Compound Name | tert-butyl N-(3,3,3-trifluoro-2-oxopropyl)carbamate |
|---|---|
| PubChem CID | 129451512 |
| Molecular Formula | C8H12F3NO3 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | tert-butyl N-(3,3,3-trifluoro-2-oxopropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO3/c1-7(2,3)15-6(14)12-4-5(13)8(9,10)11/h4H2,1-3H3,(H,12,14) |
| InChIKey | LZMVAXDJRXUUFY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |