C11H18F3N2O3+ — CID 7020972
2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl-(4,4,4-trifluoro-3-oxobutylidene)azanium (PubChem CID 7020972) has the molecular formula C11H18F3N2O3+ and a molecular weight of 283.27 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl-(4,4,4-trifluoro-3-oxobutylidene)azanium.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl-(4,4,4-trifluoro-3-oxobutylidene)azanium |
|---|---|
| PubChem CID | 7020972 |
| Molecular Formula | C11H18F3N2O3+ |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl-(4,4,4-trifluoro-3-oxobutylidene)azanium |
| SMILES | CC(C)(C)OC(=O)NCC/[NH+]=C/CC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O3/c1-10(2,3)19-9(18)16-7-6-15-5-4-8(17)11(12,13)14/h5H,4,6-7H2,1-3H3,(H,16,18)/p+1/b15-5+ |
| InChIKey | YPKPTDVRKOZSJQ-PJQLUOCWSA-O |
| XLogP | 0.18 |
| TPSA | 69.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|