C12H23FN2O2 — CID 130067864
tert-butyl N-[(3-amino-1-fluorocyclohexyl)methyl]carbamate (PubChem CID 130067864) has the molecular formula C12H23FN2O2 and a molecular weight of 246.33 g/mol. Its IUPAC name is tert-butyl N-[(3-amino-1-fluorocyclohexyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(3-amino-1-fluorocyclohexyl)methyl]carbamate |
|---|---|
| PubChem CID | 130067864 |
| Molecular Formula | C12H23FN2O2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | tert-butyl N-[(3-amino-1-fluorocyclohexyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(F)CCCC(N)C1 |
| InChI | InChI=1S/C12H23FN2O2/c1-11(2,3)17-10(16)15-8-12(13)6-4-5-9(14)7-12/h9H,4-8,14H2,1-3H3,(H,15,16) |
| InChIKey | HJHXPNAMKWYCOQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |