C14H23FN2O3 — CID 166415186
tert-butyl N-[[(1R,3S)-1-fluoro-3-(prop-2-enoylamino)cyclopentyl]methyl]carbamate (PubChem CID 166415186) has the molecular formula C14H23FN2O3 and a molecular weight of 286.35 g/mol. Its IUPAC name is tert-butyl N-[[(1R,3S)-1-fluoro-3-(prop-2-enoylamino)cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(1R,3S)-1-fluoro-3-(prop-2-enoylamino)cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 166415186 |
| Molecular Formula | C14H23FN2O3 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | tert-butyl N-[[(1R,3S)-1-fluoro-3-(prop-2-enoylamino)cyclopentyl]methyl]carbamate |
| SMILES | C=CC(=O)N[C@H]1CC[C@](F)(CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H23FN2O3/c1-5-11(18)17-10-6-7-14(15,8-10)9-16-12(19)20-13(2,3)4/h5,10H,1,6-9H2,2-4H3,(H,16,19)(H,17,18)/t10-,14+/m0/s1 |
| InChIKey | JNHYKMDGHUTQPS-IINYFYTJSA-N |
| XLogP | 2.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|