C12H24N2O5S — CID 153295984
1-hydroxy-1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-4-(sulfinoamino)cyclohexane (PubChem CID 153295984) has the molecular formula C12H24N2O5S and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-hydroxy-1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-4-(sulfinoamino)cyclohexane.
| Compound Name | 1-hydroxy-1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-4-(sulfinoamino)cyclohexane |
|---|---|
| PubChem CID | 153295984 |
| Molecular Formula | C12H24N2O5S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-hydroxy-1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-4-(sulfinoamino)cyclohexane |
| SMILES | CC(C)(C)OC(=O)NCC1(O)CCC(NS(=O)O)CC1 |
| InChI | InChI=1S/C12H24N2O5S/c1-11(2,3)19-10(15)13-8-12(16)6-4-9(5-7-12)14-20(17)18/h9,14,16H,4-8H2,1-3H3,(H,13,15)(H,17,18) |
| InChIKey | AYLUOHQFAHCXNC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|