C14H25NO5S — CID 161105071
tert-butyl N-[(1-formyl-4-methylcyclohexyl)methyl]carbamate;sulfur dioxide (PubChem CID 161105071) has the molecular formula C14H25NO5S and a molecular weight of 319.42 g/mol. Its IUPAC name is tert-butyl N-[(1-formyl-4-methylcyclohexyl)methyl]carbamate;sulfur dioxide.
| Compound Name | tert-butyl N-[(1-formyl-4-methylcyclohexyl)methyl]carbamate;sulfur dioxide |
|---|---|
| PubChem CID | 161105071 |
| Molecular Formula | C14H25NO5S |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | tert-butyl N-[(1-formyl-4-methylcyclohexyl)methyl]carbamate;sulfur dioxide |
| SMILES | CC1CCC(C=O)(CNC(=O)OC(C)(C)C)CC1.O=S=O |
| InChI | InChI=1S/C14H25NO3.O2S/c1-11-5-7-14(10-16,8-6-11)9-15-12(17)18-13(2,3)4;1-3-2/h10-11H,5-9H2,1-4H3,(H,15,17); |
| InChIKey | UIYGNIBIZOPERH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|