C30H60N4O5 — CID 157419869
tert-butyl N-(2-aminoethyl)carbamate;tert-butyl N-[2-[(4-methylcyclohexyl)methylamino]ethyl]carbamate;4-methylcyclohexane-1-carbaldehyde (PubChem CID 157419869) has the molecular formula C30H60N4O5 and a molecular weight of 556.83 g/mol. Its IUPAC name is tert-butyl N-(2-aminoethyl)carbamate;tert-butyl N-[2-[(4-methylcyclohexyl)methylamino]ethyl]carbamate;4-methylcyclohexane-1-carbaldehyde.
| Compound Name | tert-butyl N-(2-aminoethyl)carbamate;tert-butyl N-[2-[(4-methylcyclohexyl)methylamino]ethyl]carbamate;4-methylcyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 157419869 |
| Molecular Formula | C30H60N4O5 |
| Molecular Weight | 556.83 g/mol |
| Exact Mass | 556.46 |
| IUPAC Name | tert-butyl N-(2-aminoethyl)carbamate;tert-butyl N-[2-[(4-methylcyclohexyl)methylamino]ethyl]carbamate;4-methylcyclohexane-1-carbaldehyde |
| SMILES | CC(C)(C)OC(=O)NCCN.CC1CCC(C=O)CC1.CC1CCC(CNCCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H30N2O2.C8H14O.C7H16N2O2/c1-12-5-7-13(8-6-12)11-16-9-10-17-14(18)19-15(2,3)4;1-7-2-4-8(6-9)5-3-7;1-7(2,3)11-6(10)9-5-4-8/h12-13,16H,5-11H2,1-4H3,(H,17,18);6-8H,2-5H2,1H3;4-5,8H2,1-3H3,(H,9,10) |
| InChIKey | BPGZEEWHIWOKNW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.83 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|