C13H27N3O5S — CID 163947418
tert-butyl N-[[1-hydroxy-4-(methylamino)-4-sulfamoylcyclohexyl]methyl]carbamate (PubChem CID 163947418) has the molecular formula C13H27N3O5S and a molecular weight of 337.44 g/mol. Its IUPAC name is tert-butyl N-[[1-hydroxy-4-(methylamino)-4-sulfamoylcyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-hydroxy-4-(methylamino)-4-sulfamoylcyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 163947418 |
| Molecular Formula | C13H27N3O5S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | tert-butyl N-[[1-hydroxy-4-(methylamino)-4-sulfamoylcyclohexyl]methyl]carbamate |
| SMILES | CNC1(S(N)(=O)=O)CCC(O)(CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H27N3O5S/c1-11(2,3)21-10(17)16-9-12(18)5-7-13(15-4,8-6-12)22(14,19)20/h15,18H,5-9H2,1-4H3,(H,16,17)(H2,14,19,20) |
| InChIKey | RWILMIYQUHWALB-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |