C11H21NO5 — CID 167723194
tert-butyl N-[(3,4-dihydroxyoxan-3-yl)methyl]carbamate (PubChem CID 167723194) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is tert-butyl N-[(3,4-dihydroxyoxan-3-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(3,4-dihydroxyoxan-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 167723194 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | tert-butyl N-[(3,4-dihydroxyoxan-3-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(O)COCCC1O |
| InChI | InChI=1S/C11H21NO5/c1-10(2,3)17-9(14)12-6-11(15)7-16-5-4-8(11)13/h8,13,15H,4-7H2,1-3H3,(H,12,14) |
| InChIKey | HEBKORHLILQVRN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |