C11H17NO3 — CID 53415225
tert-butyl N-[(3-ethynyloxetan-3-yl)methyl]carbamate (PubChem CID 53415225) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is tert-butyl N-[(3-ethynyloxetan-3-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(3-ethynyloxetan-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 53415225 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | tert-butyl N-[(3-ethynyloxetan-3-yl)methyl]carbamate |
| SMILES | C#CC1(CNC(=O)OC(C)(C)C)COC1 |
| InChI | InChI=1S/C11H17NO3/c1-5-11(7-14-8-11)6-12-9(13)15-10(2,3)4/h1H,6-8H2,2-4H3,(H,12,13) |
| InChIKey | KRSNEVLNKSYXTC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|