C13H21FN2O3 — CID 166410433
tert-butyl N-[[1-fluoro-3-(prop-2-enoylamino)cyclobutyl]methyl]carbamate (PubChem CID 166410433) has the molecular formula C13H21FN2O3 and a molecular weight of 272.32 g/mol. Its IUPAC name is tert-butyl N-[[1-fluoro-3-(prop-2-enoylamino)cyclobutyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-fluoro-3-(prop-2-enoylamino)cyclobutyl]methyl]carbamate |
|---|---|
| PubChem CID | 166410433 |
| Molecular Formula | C13H21FN2O3 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | tert-butyl N-[[1-fluoro-3-(prop-2-enoylamino)cyclobutyl]methyl]carbamate |
| SMILES | C=CC(=O)NC1CC(F)(CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H21FN2O3/c1-5-10(17)16-9-6-13(14,7-9)8-15-11(18)19-12(2,3)4/h5,9H,1,6-8H2,2-4H3,(H,15,18)(H,16,17) |
| InChIKey | XUTXGRHTMYMCQF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|