C11H20F2N2O2 — CID 76672221
tert-butyl N-(6-amino-2,2-difluorocyclohexyl)carbamate (PubChem CID 76672221) has the molecular formula C11H20F2N2O2 and a molecular weight of 250.29 g/mol. Its IUPAC name is tert-butyl N-(6-amino-2,2-difluorocyclohexyl)carbamate.
| Compound Name | tert-butyl N-(6-amino-2,2-difluorocyclohexyl)carbamate |
|---|---|
| PubChem CID | 76672221 |
| Molecular Formula | C11H20F2N2O2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | tert-butyl N-(6-amino-2,2-difluorocyclohexyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1C(N)CCCC1(F)F |
| InChI | InChI=1S/C11H20F2N2O2/c1-10(2,3)17-9(16)15-8-7(14)5-4-6-11(8,12)13/h7-8H,4-6,14H2,1-3H3,(H,15,16) |
| InChIKey | KYRXOCVGTONVGN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |