C10H19IN2O4 — CID 18629483
tert-butyl N-[3-(iodomethoxycarbonylamino)propyl]carbamate (PubChem CID 18629483) has the molecular formula C10H19IN2O4 and a molecular weight of 358.18 g/mol. Its IUPAC name is tert-butyl N-[3-(iodomethoxycarbonylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(iodomethoxycarbonylamino)propyl]carbamate |
|---|---|
| PubChem CID | 18629483 |
| Molecular Formula | C10H19IN2O4 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | tert-butyl N-[3-(iodomethoxycarbonylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC(=O)OCI |
| InChI | InChI=1S/C10H19IN2O4/c1-10(2,3)17-9(15)13-6-4-5-12-8(14)16-7-11/h4-7H2,1-3H3,(H,12,14)(H,13,15) |
| InChIKey | TYPKILRVJPMEMV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|