C22H32N2O4 — CID 174193171
2-O-benzyl 1-O-tert-butyl (4R)-4-(dimethylamino)-2-prop-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 174193171) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (4R)-4-(dimethylamino)-2-prop-2-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl (4R)-4-(dimethylamino)-2-prop-2-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 174193171 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (4R)-4-(dimethylamino)-2-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCC1(C(=O)OCc2ccccc2)C[C@@H](N(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H32N2O4/c1-7-13-22(19(25)27-16-17-11-9-8-10-12-17)14-18(23(5)6)15-24(22)20(26)28-21(2,3)4/h7-12,18H,1,13-16H2,2-6H3/t18-,22?/m1/s1 |
| InChIKey | FHBGTMSZVLRGEZ-ZZWBGTBQSA-N |
| XLogP | 3.62 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|