C28H35NO5 — CID 152707496
2-O-benzyl 1-O-tert-butyl (4R)-2-but-2-enyl-4-phenylmethoxypyrrolidine-1,2-dicarboxylate (PubChem CID 152707496) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (4R)-2-but-2-enyl-4-phenylmethoxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl (4R)-2-but-2-enyl-4-phenylmethoxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 152707496 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (4R)-2-but-2-enyl-4-phenylmethoxypyrrolidine-1,2-dicarboxylate |
| SMILES | CC=CCC1(C(=O)OCc2ccccc2)C[C@@H](OCc2ccccc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H35NO5/c1-5-6-17-28(25(30)33-21-23-15-11-8-12-16-23)18-24(32-20-22-13-9-7-10-14-22)19-29(28)26(31)34-27(2,3)4/h5-16,24H,17-21H2,1-4H3/t24-,28?/m1/s1 |
| InChIKey | ZSWXGRHHMZRKSJ-RIBGEGAISA-N |
| XLogP | 5.66 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|