C35H47N3O7 — CID 139426206
dibenzyl 2-[(E)-but-2-enyl]-4-[methyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]pyrrolidine-1,2-dicarboxylate (PubChem CID 139426206) has the molecular formula C35H47N3O7 and a molecular weight of 621.78 g/mol. Its IUPAC name is dibenzyl 2-[(E)-but-2-enyl]-4-[methyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]pyrrolidine-1,2-dicarboxylate.
| Compound Name | dibenzyl 2-[(E)-but-2-enyl]-4-[methyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139426206 |
| Molecular Formula | C35H47N3O7 |
| Molecular Weight | 621.78 g/mol |
| Exact Mass | 621.34 |
| IUPAC Name | dibenzyl 2-[(E)-but-2-enyl]-4-[methyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]pyrrolidine-1,2-dicarboxylate |
| SMILES | C/C=C/CC1(C(=O)OCc2ccccc2)CC(N(C)C(=O)C(NC(=O)OC(C)(C)C)C(C)C)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H47N3O7/c1-8-9-20-35(31(40)43-23-26-16-12-10-13-17-26)21-28(22-38(35)33(42)44-24-27-18-14-11-15-19-27)37(7)30(39)29(25(2)3)36-32(41)45-34(4,5)6/h8-19,25,28-29H,20-24H2,1-7H3,(H,36,41)/b9-8+ |
| InChIKey | RBQHSUFEHYTJTF-CMDGGOBGSA-N |
| XLogP | 5.85 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.78 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|