C21H28N4O4 — CID 139415639
2-O-benzyl 1-O-tert-butyl (4S)-4-azido-2-but-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 139415639) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (4S)-4-azido-2-but-2-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl (4S)-4-azido-2-but-2-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139415639 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (4S)-4-azido-2-but-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | CC=CCC1(C(=O)OCc2ccccc2)C[C@H](N=[N+]=[N-])CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H28N4O4/c1-5-6-12-21(18(26)28-15-16-10-8-7-9-11-16)13-17(23-24-22)14-25(21)19(27)29-20(2,3)4/h5-11,17H,12-15H2,1-4H3/t17-,21?/m0/s1 |
| InChIKey | CNMBWTHWMVKWLP-PBVYKCSPSA-N |
| XLogP | 4.75 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|