C27H41BN4O6 — CID 172795903
2-O-benzyl 1-O-tert-butyl 4-azido-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 172795903) has the molecular formula C27H41BN4O6 and a molecular weight of 528.46 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl 4-azido-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl 4-azido-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 172795903 |
| Molecular Formula | C27H41BN4O6 |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl 4-azido-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(N=[N+]=[N-])CC1(CCCCB1OC(C)(C)C(C)(C)O1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H41BN4O6/c1-24(2,3)36-23(34)32-18-21(30-31-29)17-27(32,22(33)35-19-20-13-9-8-10-14-20)15-11-12-16-28-37-25(4,5)26(6,7)38-28/h8-10,13-14,21H,11-12,15-19H2,1-7H3 |
| InChIKey | QEVCPPIQPTYOFC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 123.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|