C29H40BNO5 — CID 174193032
benzyl (4R)-4-phenylmethoxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylate (PubChem CID 174193032) has the molecular formula C29H40BNO5 and a molecular weight of 493.45 g/mol. Its IUPAC name is benzyl (4R)-4-phenylmethoxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (4R)-4-phenylmethoxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 174193032 |
| Molecular Formula | C29H40BNO5 |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | benzyl (4R)-4-phenylmethoxy-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxylate |
| SMILES | CC1(C)OB(CCCCC2(C(=O)OCc3ccccc3)C[C@@H](OCc3ccccc3)CN2)OC1(C)C |
| InChI | InChI=1S/C29H40BNO5/c1-27(2)28(3,4)36-30(35-27)18-12-11-17-29(26(32)34-22-24-15-9-6-10-16-24)19-25(20-31-29)33-21-23-13-7-5-8-14-23/h5-10,13-16,25,31H,11-12,17-22H2,1-4H3/t25-,29?/m1/s1 |
| InChIKey | KXSXQYLHDXTSGI-MIJJZIGMSA-N |
| XLogP | 5.31 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|