C25H42BN3O7S — CID 175045706
benzyl 3-amino-1-[(2-hydroxy-2-methylpropyl)sulfamoyl]-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxylate (PubChem CID 175045706) has the molecular formula C25H42BN3O7S and a molecular weight of 539.50 g/mol. Its IUPAC name is benzyl 3-amino-1-[(2-hydroxy-2-methylpropyl)sulfamoyl]-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxylate.
| Compound Name | benzyl 3-amino-1-[(2-hydroxy-2-methylpropyl)sulfamoyl]-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 175045706 |
| Molecular Formula | C25H42BN3O7S |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | benzyl 3-amino-1-[(2-hydroxy-2-methylpropyl)sulfamoyl]-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxylate |
| SMILES | CC(C)(O)CNS(=O)(=O)N1CC(CCCB2OC(C)(C)C(C)(C)O2)C(N)(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C25H42BN3O7S/c1-22(2,31)17-28-37(32,33)29-15-20(13-10-14-26-35-23(3,4)24(5,6)36-26)25(27,18-29)21(30)34-16-19-11-8-7-9-12-19/h7-9,11-12,20,28,31H,10,13-18,27H2,1-6H3 |
| InChIKey | SUIGVOKMTKXQRN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|