C16H32BN3O7S — CID 155627375
(3R,4S)-3-amino-1-(2-hydroxyethylsulfamoyl)-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxylic acid (PubChem CID 155627375) has the molecular formula C16H32BN3O7S and a molecular weight of 421.33 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-(2-hydroxyethylsulfamoyl)-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-(2-hydroxyethylsulfamoyl)-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155627375 |
| Molecular Formula | C16H32BN3O7S |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | (3R,4S)-3-amino-1-(2-hydroxyethylsulfamoyl)-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC1(C)OB(CCC[C@H]2CN(S(=O)(=O)NCCO)C[C@@]2(N)C(=O)O)OC1(C)C |
| InChI | InChI=1S/C16H32BN3O7S/c1-14(2)15(3,4)27-17(26-14)7-5-6-12-10-20(11-16(12,18)13(22)23)28(24,25)19-8-9-21/h12,19,21H,5-11,18H2,1-4H3,(H,22,23)/t12-,16-/m0/s1 |
| InChIKey | ZJBOXXSBZLXMRM-LRDDRELGSA-N |
| XLogP | -0.60 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|