C14H29BN4O6S — CID 155627487
(3R,4S)-3-amino-1-[(2-aminocyclohexyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 155627487) has the molecular formula C14H29BN4O6S and a molecular weight of 392.29 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-[(2-aminocyclohexyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-[(2-aminocyclohexyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155627487 |
| Molecular Formula | C14H29BN4O6S |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (3R,4S)-3-amino-1-[(2-aminocyclohexyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | NC1CCCCC1NS(=O)(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C14H29BN4O6S/c16-11-5-1-2-6-12(11)18-26(24,25)19-8-10(4-3-7-15(22)23)14(17,9-19)13(20)21/h10-12,18,22-23H,1-9,16-17H2,(H,20,21)/t10-,11?,12?,14-/m0/s1 |
| InChIKey | WCURKBJZQSIJLC-BBCYWQGDSA-N |
| XLogP | -1.94 |
| TPSA | 179.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|