C10H21BN4O7S — CID 155627405
(3R,4S)-3-amino-1-[(2-amino-2-oxoethyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 155627405) has the molecular formula C10H21BN4O7S and a molecular weight of 352.18 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-[(2-amino-2-oxoethyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-[(2-amino-2-oxoethyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155627405 |
| Molecular Formula | C10H21BN4O7S |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (3R,4S)-3-amino-1-[(2-amino-2-oxoethyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | NC(=O)CNS(=O)(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C10H21BN4O7S/c12-8(16)4-14-23(21,22)15-5-7(2-1-3-11(19)20)10(13,6-15)9(17)18/h7,14,19-20H,1-6,13H2,(H2,12,16)(H,17,18)/t7-,10-/m0/s1 |
| InChIKey | MZPSXHJWFNLFIS-XVKPBYJWSA-N |
| XLogP | -3.73 |
| TPSA | 196.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|