C12H26BFN4O6S — CID 164837649
(3R,4S)-3-amino-1-[2-aminoethyl(2-fluoroethyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 164837649) has the molecular formula C12H26BFN4O6S and a molecular weight of 384.24 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-[2-aminoethyl(2-fluoroethyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-[2-aminoethyl(2-fluoroethyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164837649 |
| Molecular Formula | C12H26BFN4O6S |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (3R,4S)-3-amino-1-[2-aminoethyl(2-fluoroethyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | NCCN(CCF)S(=O)(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C12H26BFN4O6S/c14-4-6-17(7-5-15)25(23,24)18-8-10(2-1-3-13(21)22)12(16,9-18)11(19)20/h10,21-22H,1-9,15-16H2,(H,19,20)/t10-,12-/m0/s1 |
| InChIKey | VSKRLXWMSPWPKV-JQWIXIFHSA-N |
| XLogP | -2.57 |
| TPSA | 170.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|