C12H27BN4O6S — CID 164837844
(3R,4S)-3-amino-1-[2-aminoethyl(ethyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 164837844) has the molecular formula C12H27BN4O6S and a molecular weight of 366.25 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-[2-aminoethyl(ethyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-[2-aminoethyl(ethyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164837844 |
| Molecular Formula | C12H27BN4O6S |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (3R,4S)-3-amino-1-[2-aminoethyl(ethyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCN(CCN)S(=O)(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C12H27BN4O6S/c1-2-16(7-6-14)24(22,23)17-8-10(4-3-5-13(20)21)12(15,9-17)11(18)19/h10,20-21H,2-9,14-15H2,1H3,(H,18,19)/t10-,12-/m0/s1 |
| InChIKey | LDYQBBXULNNCEK-JQWIXIFHSA-N |
| XLogP | -2.52 |
| TPSA | 170.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|