C14H31BN4O6S — CID 164837613
(3R,4S)-3-amino-1-[2-aminoethyl(tert-butyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 164837613) has the molecular formula C14H31BN4O6S and a molecular weight of 394.30 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-[2-aminoethyl(tert-butyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-[2-aminoethyl(tert-butyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164837613 |
| Molecular Formula | C14H31BN4O6S |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (3R,4S)-3-amino-1-[2-aminoethyl(tert-butyl)sulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC(C)(C)N(CCN)S(=O)(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C14H31BN4O6S/c1-13(2,3)19(8-7-16)26(24,25)18-9-11(5-4-6-15(22)23)14(17,10-18)12(20)21/h11,22-23H,4-10,16-17H2,1-3H3,(H,20,21)/t11-,14-/m0/s1 |
| InChIKey | SRURMWJWIIGAIY-FZMZJTMJSA-N |
| XLogP | -1.74 |
| TPSA | 170.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|