C15H30BN5O7S — CID 164837585
(3R,4S)-3-amino-4-(3-boronopropyl)-1-[cyclobutyl(2,3-diaminopropanoyl)sulfamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 164837585) has the molecular formula C15H30BN5O7S and a molecular weight of 435.31 g/mol. Its IUPAC name is (3R,4S)-3-amino-4-(3-boronopropyl)-1-[cyclobutyl(2,3-diaminopropanoyl)sulfamoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-[cyclobutyl(2,3-diaminopropanoyl)sulfamoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164837585 |
| Molecular Formula | C15H30BN5O7S |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-[cyclobutyl(2,3-diaminopropanoyl)sulfamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | NCC(N)C(=O)N(C1CCC1)S(=O)(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C15H30BN5O7S/c17-7-12(18)13(22)21(11-4-1-5-11)29(27,28)20-8-10(3-2-6-16(25)26)15(19,9-20)14(23)24/h10-12,25-26H,1-9,17-19H2,(H,23,24)/t10-,12?,15-/m0/s1 |
| InChIKey | KXDRXMUZKVSNNH-BTXGZQJSSA-N |
| XLogP | -3.13 |
| TPSA | 213.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|