C17H27BN4O8S — CID 164837859
(3R,4S)-3-amino-1-[(2-amino-2-carboxyethyl)-phenylsulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid (PubChem CID 164837859) has the molecular formula C17H27BN4O8S and a molecular weight of 458.30 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-[(2-amino-2-carboxyethyl)-phenylsulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-1-[(2-amino-2-carboxyethyl)-phenylsulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164837859 |
| Molecular Formula | C17H27BN4O8S |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (3R,4S)-3-amino-1-[(2-amino-2-carboxyethyl)-phenylsulfamoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| SMILES | NC(CN(c1ccccc1)S(=O)(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1)C(=O)O |
| InChI | InChI=1S/C17H27BN4O8S/c19-14(15(23)24)10-22(13-6-2-1-3-7-13)31(29,30)21-9-12(5-4-8-18(27)28)17(20,11-21)16(25)26/h1-3,6-7,12,14,27-28H,4-5,8-11,19-20H2,(H,23,24)(H,25,26)/t12-,14?,17-/m0/s1 |
| InChIKey | UMMSQANYUFBEPG-XTIDWKMFSA-N |
| XLogP | -1.88 |
| TPSA | 207.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|