C16H34BN4O6S+ — CID 164837952
(3R,4S)-3-amino-4-(3-boronopropyl)-1-[(1,1-dimethylazetidin-1-ium-3-yl)-propan-2-ylsulfamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 164837952) has the molecular formula C16H34BN4O6S+ and a molecular weight of 421.35 g/mol. Its IUPAC name is (3R,4S)-3-amino-4-(3-boronopropyl)-1-[(1,1-dimethylazetidin-1-ium-3-yl)-propan-2-ylsulfamoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-[(1,1-dimethylazetidin-1-ium-3-yl)-propan-2-ylsulfamoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164837952 |
| Molecular Formula | C16H34BN4O6S+ |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-[(1,1-dimethylazetidin-1-ium-3-yl)-propan-2-ylsulfamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC(C)N(C1C[N+](C)(C)C1)S(=O)(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C16H33BN4O6S/c1-12(2)20(14-9-21(3,4)10-14)28(26,27)19-8-13(6-5-7-17(24)25)16(18,11-19)15(22)23/h12-14,24-25H,5-11,18H2,1-4H3/p+1/t13-,16-/m0/s1 |
| InChIKey | SYFDISJGAYSCGF-BBRMVZONSA-O |
| XLogP | -1.63 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|