C15H34BN4O6S+ — CID 164837617
2-[[(3R,4S)-3-amino-4-(3-boronopropyl)-3-carboxypyrrolidin-1-yl]sulfonyl-ethylamino]ethyl-trimethylazanium (PubChem CID 164837617) has the molecular formula C15H34BN4O6S+ and a molecular weight of 409.34 g/mol. Its IUPAC name is 2-[[(3R,4S)-3-amino-4-(3-boronopropyl)-3-carboxypyrrolidin-1-yl]sulfonyl-ethylamino]ethyl-trimethylazanium.
| Compound Name | 2-[[(3R,4S)-3-amino-4-(3-boronopropyl)-3-carboxypyrrolidin-1-yl]sulfonyl-ethylamino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 164837617 |
| Molecular Formula | C15H34BN4O6S+ |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 2-[[(3R,4S)-3-amino-4-(3-boronopropyl)-3-carboxypyrrolidin-1-yl]sulfonyl-ethylamino]ethyl-trimethylazanium |
| SMILES | CCN(CC[N+](C)(C)C)S(=O)(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C15H33BN4O6S/c1-5-18(9-10-20(2,3)4)27(25,26)19-11-13(7-6-8-16(23)24)15(17,12-19)14(21)22/h13,23-24H,5-12,17H2,1-4H3/p+1/t13-,15-/m0/s1 |
| InChIKey | NJRJPQBCIKKAAR-ZFWWWQNUSA-O |
| XLogP | -1.77 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|